≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCC1=CC(=C(S1)NC(=O)CCl)C(=O)C2=CC=CC=C2Cl |
|---|---|
| IUPAC Name | 2-chloro-N-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]acetamide |
| InChIKey | RWDKLJQZPVCCTO-UHFFFAOYSA-N |
| INCHI | 1S/C15H13Cl2NO2S/c1-2-9-7-11(15(21-9)18-13(19)8-16)14(20)10-5-3-4-6-12(10)17/h3-7H,2,8H2,1H3,(H,18,19) |
| Isómeros SMILES | CCC1=CC(=C(S1)NC(=O)CCl)C(=O)C2=CC=CC=C2Cl |
| PubChem CID | 12562369 |
| Peso molecular | 342.2 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Aryl-phenylketones |
| Alternative Parents | 3-aroylthiophenes Thiophene carboxylic acids and derivatives 2,3,5-trisubstituted thiophenes N-arylamides Benzoyl derivatives Chlorobenzenes Aryl chlorides Vinylogous halides Vinylogous amides Heteroaromatic compounds Chloroacetamides Secondary carboxylic acid amides Organic oxides Alkyl chlorides Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl-phenylketone - 3-aroylthiophene - Benzoyl - Thiophene carboxylic acid or derivatives - 2,3,5-trisubstituted thiophene - N-arylamide - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Chloroacetamide - Heteroaromatic compound - Vinylogous amide - Thiophene - Vinylogous halide - Carboxamide group - Secondary carboxylic acid amide - Organoheterocyclic compound - Carboxylic acid derivative - Organochloride - Organohalogen compound - Alkyl halide - Hydrocarbon derivative - Organic oxide - Organonitrogen compound - Organic nitrogen compound - Alkyl chloride - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aryl-phenylketones. These are aromatic compounds containing a ketone substituted by one aryl group, and a phenyl group. |
| External Descriptors | Not available |
| Peso molecular | 342.200 g/mol |
|---|---|
| XLogP3 | 5.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 341.004 Da |
| Monoisotopic Mass | 341.004 Da |
| Topological Polar Surface Area | 74.400 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 394.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
