≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCN(C1=CC=C(C=C1)NC(=O)CCl)C(C)C.Cl |
|---|---|
| IUPAC Name | 2-chloro-N-[4-[ethyl(propan-2-yl)amino]phenyl]acetamide;hydrochloride |
| InChIKey | NAWIFQYVUQWTHF-UHFFFAOYSA-N |
| INCHI | 1S/C13H19ClN2O.ClH/c1-4-16(10(2)3)12-7-5-11(6-8-12)15-13(17)9-14;/h5-8,10H,4,9H2,1-3H3,(H,15,17);1H |
| Peso molecular | 291.21 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Aralkylamines - Phenylalkylamines |
| Direct Parent | Phenylisopropylamines |
| Alternative Parents | Anilides N-arylamides Dialkylarylamines Aniline and substituted anilines Chloroacetamides Secondary carboxylic acid amides Amino acids and derivatives Organopnictogen compounds Organochlorides Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylisopropylamine - Anilide - Tertiary aliphatic/aromatic amine - N-arylamide - Aniline or substituted anilines - Dialkylarylamine - Monocyclic benzene moiety - Benzenoid - Chloroacetamide - Amino acid or derivatives - Carboxamide group - Secondary carboxylic acid amide - Tertiary amine - Carboxylic acid derivative - Organopnictogen compound - Alkyl chloride - Organooxygen compound - Organochloride - Organohalogen compound - Alkyl halide - Carbonyl group - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Hydrochloride - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylisopropylamines. These are organic aromatic compounds containing a 1-phenylpropan-2-amine moiety. |
| External Descriptors | Not available |
| Peso molecular | 291.210 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 5 |
| Exact Mass | 290.095 Da |
| Monoisotopic Mass | 290.095 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 238.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
![2-chloro-N-{4-[ethyl(propan-2-yl)amino]phenyl}acetamide hydrochloride - ≥95% , CAS No.1027643-27-1](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)