Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=NN2C(NC1=O)SC=C2NC(=O)CCl |
|---|---|
| IUPAC Name | 2-chloro-N-(6-methyl-7-oxo-8,8a-dihydro-[1,3]thiazolo[3,2-b][1,2,4]triazin-3-yl)acetamide |
| InChIKey | ZHALGNAGGUQCGZ-UHFFFAOYSA-N |
| INCHI | 1S/C8H9ClN4O2S/c1-4-7(15)11-8-13(12-4)5(3-16-8)10-6(14)2-9/h3,8H,2H2,1H3,(H,10,14)(H,11,15) |
| Isómeros SMILES | CC1=NN2C(NC1=O)SC=C2NC(=O)CCl |
| CAS alternativo | 1256627-72-1 |
| PubChem CID | 50878111 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Triazines |
| Subclass | 1,2,4-triazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,2,4-triazines |
| Alternative Parents | Thiazolines Chloroacetamides Thioenol ethers Secondary carboxylic acid amides N-alkylated hydrazones Lactams Azacyclic compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | 1,2,4-triazine - Chloroacetamide - Meta-thiazoline - Carboxamide group - Lactam - Secondary carboxylic acid amide - Thioenolether - N-alkylated hydrazone - Carboxylic acid derivative - Hydrazone - Azacycle - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Alkyl chloride - Organic nitrogen compound - Carbonyl group - Organic oxide - Hydrocarbon derivative - Alkyl halide - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 1,2,4-triazines. These are compounds containing a triazine ring, which is a heterocyclic ring, similar to the six-member benzene ring but with three carbons replaced by nitrogen atoms, at ring positions 1, 2, and 4. |
| External Descriptors | Not available |
| Peso molecular | 260.700 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 260.013 Da |
| Monoisotopic Mass | 260.013 Da |
| Topological Polar Surface Area | 99.100 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 409.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |