suitable for cell culture,Endotoxin<50EU/g;Microbial Limit≤100cfu/g for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1C(C(OC1N2C=NC3=C2N=C(NC3=O)N)CO)O.O |
|---|---|
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one;hydrate |
| InChIKey | LZSCQUCOIRGCEJ-FPKZOZHISA-N |
| INCHI | 1S/C10H13N5O4.H2O/c11-10-13-8-7(9(18)14-10)12-3-15(8)6-1-4(17)5(2-16)19-6;/h3-6,16-17H,1-2H2,(H3,11,13,14,18);1H2/t4-,5+,6+;/m0./s1 |
| Isómeros SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(NC3=O)N)CO)O.O |
| PubChem CID | 135445705 |
| Peso molecular | 285.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Nucleosides, nucleotides, and analogues |
| Clase | Purine nucleosides |
| Subclass | Purine 2'-deoxyribonucleosides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Purine 2'-deoxyribonucleosides |
| Alternative Parents | Hypoxanthines Hydroxypyrimidines Aminopyrimidines and derivatives N-substituted imidazoles Oxolanes Heteroaromatic compounds Secondary alcohols Oxacyclic compounds Azacyclic compounds Primary amines Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Purine 2'-deoxyribonucleoside - Hypoxanthine - Imidazopyrimidine - Purine - Aminopyrimidine - Hydroxypyrimidine - N-substituted imidazole - Pyrimidine - Azole - Imidazole - Heteroaromatic compound - Oxolane - Secondary alcohol - Oxacycle - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Primary alcohol - Primary amine - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as purine 2'-deoxyribonucleosides. These are compounds consisting of a purine linked to a ribose which lacks a hydroxyl group at position 2. |
| External Descriptors | Not available |
| Solubilidad | solubility 1 M NH4OH: 50 mg/mL |
|---|---|
| Rotación específica [α] | [α]20/D -30°, c = 0.2 in H2O |
| Punto de fusión (°C) | >300°C |
| Peso molecular | 285.260 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 2 |
| Exact Mass | 285.107 Da |
| Monoisotopic Mass | 285.107 Da |
| Topological Polar Surface Area | 136.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 417.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Qian Wang, Huanshun Yin, Yunlei Zhou, Jun Wang, Shiyun Ai. (2021) Photoelectrochemical biosensor for 5-formylcytosine deoxyribonucleoside detection based on BiIO4-WS2/CuO ternary heterojunction. SENSORS AND ACTUATORS B-CHEMICAL, [PMID:] [10.1016/j.snb.2021.130019] |
