Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488199385 |
|---|---|
| Sonrisas canónicas | CCCC[Sn](CCCC)(CCCC)C1=CC(=NC=C1)F |
| IUPAC Name | tributyl-(2-fluoropyridin-4-yl)stannane |
| InChIKey | YGKPEWRENKJYRP-UHFFFAOYSA-N |
| INCHI | 1S/C5H3FN.3C4H9.Sn/c6-5-3-1-2-4-7-5;3*1-3-4-2;/h2-4H;3*1,3-4H2,2H3; |
| Isómeros SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC(=NC=C1)F |
| WGK Alemania | 3 |
| Peso molecular | 386.14 |
| Reaxy-Rn | 14531237 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14531237&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | Halopyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-halopyridines |
| Alternative Parents | Metal aryls Aryl fluorides Heteroaromatic compounds Trialkyltins Azacyclic compounds Organonitrogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2-halopyridine - Aryl fluoride - Metal aryl - Aryl halide - Heteroaromatic compound - Trialkyltin - Azacycle - Organic nitrogen compound - Organotin compound - Organonitrogen compound - Organometallic compound - Organofluoride - Organic post-transition metal moeity - Organohalogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 2-halopyridines. These are organic compounds containing a pyridine ring substituted at the 2-position by a halogen atom. |
| External Descriptors | Not available |
| Sensibilidad | air sensitive |
|---|---|
| Índice de refracción | 1.508 |
| Punto de inflamación (°F) | >230 °F |
| Punto de inflamación (°C) | >110 °C |
| Peso molecular | 386.100 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 10 |
| Exact Mass | 387.138 Da |
| Monoisotopic Mass | 387.138 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 225.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |