Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)NC(=O)CI |
|---|---|
| IUPAC Name | 2-iodo-N-(1,10-phenanthrolin-5-yl)acetamide |
| InChIKey | VNZCYEFHRZCOGS-UHFFFAOYSA-N |
| INCHI | 1S/C14H10IN3O/c15-8-12(19)18-11-7-9-3-1-5-16-13(9)14-10(11)4-2-6-17-14/h1-7H,8H2,(H,18,19) |
| Isómeros SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)NC(=O)CI |
| CAS alternativo | 111047-29-1 |
| PubChem CID | 18785373 |
| Términos de entrada MeSH | 5-iodoacetamido-1,10-phenanthroline;5-iodoacetamido-1,10-phenanthroline-copper;IAAOP;IOP cpd;N-(1,10-phenanthrolin-5-yl)iodacetamide |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Phenanthrolines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenanthrolines |
| Alternative Parents | Quinolines and derivatives N-arylamides Pyridines and derivatives Benzenoids Heteroaromatic compounds Secondary carboxylic acid amides Azacyclic compounds Organopnictogen compounds Organoiodides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl iodides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1,10-phenanthroline - Quinoline - N-arylamide - Pyridine - Benzenoid - Heteroaromatic compound - Carboxamide group - Secondary carboxylic acid amide - Carboxylic acid derivative - Azacycle - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organoiodide - Organohalogen compound - Alkyl halide - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Alkyl iodide - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenanthrolines. These are aromatic polycyclic compounds containing the phenanthroline skeleton, which is a derivative of phenanthrene, and consists of two pyridine rings non-linearly joined by a benzene ring. |
| External Descriptors | Not available |
| Peso molecular | 363.150 g/mol |
|---|---|
| XLogP3 | 2.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 362.987 Da |
| Monoisotopic Mass | 362.987 Da |
| Topological Polar Surface Area | 54.900 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 339.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |