≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CNCC(=O)NC1=CC=C(C=C1)OC(F)(F)F.Cl |
|---|---|
| IUPAC Name | 2-(methylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide;hydrochloride |
| InChIKey | KICMPUHGBLNMCN-UHFFFAOYSA-N |
| INCHI | 1S/C10H11F3N2O2.ClH/c1-14-6-9(16)15-7-2-4-8(5-3-7)17-10(11,12)13;/h2-5,14H,6H2,1H3,(H,15,16);1H |
| Isómeros SMILES | CNCC(=O)NC1=CC=C(C=C1)OC(F)(F)F.Cl |
| PubChem CID | 16196384 |
| Peso molecular | 284.66 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid amides |
| Alternative Parents | Anilides Phenoxy compounds Phenol ethers N-arylamides Trihalomethanes Secondary carboxylic acid amides Dialkylamines Organofluorides Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alpha-amino acid amide - Anilide - Phenol ether - N-arylamide - Phenoxy compound - Monocyclic benzene moiety - Benzenoid - Trihalomethane - Carboxamide group - Secondary carboxylic acid amide - Secondary aliphatic amine - Secondary amine - Organic oxygen compound - Alkyl halide - Alkyl fluoride - Organooxygen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Hydrochloride - Organic nitrogen compound - Carbonyl group - Hydrocarbon derivative - Amine - Halomethane - Organic oxide - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acid amides. These are amide derivatives of alpha amino acids. |
| External Descriptors | Not available |
| Peso molecular | 284.660 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 4 |
| Exact Mass | 284.054 Da |
| Monoisotopic Mass | 284.054 Da |
| Topological Polar Surface Area | 50.400 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 250.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
![2-(methylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide hydrochloride - ≥97% CAS No(1052541-17-9) by Aladdin Scientific](https://www.aladdinsci.com/media/catalog/product/cache/207e23213cf636ccdef205098cf3c8a3/M/9/M974337.jpg)