Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCC[Sn](CCCC)(CCCC)C1=CSC(=N1)SC |
|---|---|
| IUPAC Name | tributyl-(2-methylsulfanyl-1,3-thiazol-4-yl)stannane |
| InChIKey | DNYQPVUGIZBXHX-UHFFFAOYSA-N |
| INCHI | 1S/C4H4NS2.3C4H9.Sn/c1-6-4-5-2-3-7-4;3*1-3-4-2;/h3H,1H3;3*1,3-4H2,2H3; |
| Isómeros SMILES | CCCC[Sn](CCCC)(CCCC)C1=CSC(=N1)SC |
| Peso molecular | 420.3 |
| Reaxy-Rn | 14253462 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14253462&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Clase | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aryl thioethers |
| Alternative Parents | Alkylarylthioethers 2,4-disubstituted thiazoles Metal aryls Heteroaromatic compounds Trialkyltins Sulfenyl compounds Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl thioether - 2,4-disubstituted 1,3-thiazole - Alkylarylthioether - Metal aryl - Azole - Thiazole - Heteroaromatic compound - Trialkyltin - Organoheterocyclic compound - Sulfenyl compound - Azacycle - Hydrocarbon derivative - Organotin compound - Organonitrogen compound - Organometallic compound - Organic post-transition metal moeity - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aryl thioethers. These are organosulfur compounds containing a thioether group that is substituted by an aryl group. |
| External Descriptors | Not available |
| Peso molecular | 420.300 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 11 |
| Exact Mass | 421.092 Da |
| Monoisotopic Mass | 421.092 Da |
| Topological Polar Surface Area | 66.400 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 229.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |