Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Desiccated Ships Wet ice,FedEx DG Service Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C2C=C(C=CC2=C1)[N+](=O)[O-] |
|---|---|
| IUPAC Name | 2-nitronaphthalene |
| InChIKey | ZJYJZEAJZXVAMF-UHFFFAOYSA-N |
| INCHI | 1S/C10H7NO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| Isómeros SMILES | C1=CC=C2C=C(C=CC2=C1)[N+](=O)[O-] |
| WGK Alemania | 3 |
| RTECS | QJ9760000 |
| Número ONU | 2538 |
| Grupo de embalaje | III |
| Peso molecular | 173.17 |
| Beilstein | 2046354 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Naphthalenes |
| Subclass | Nitronaphthalenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitronaphthalenes |
| Alternative Parents | Nitroaromatic compounds Propargyl-type 1,3-dipolar organic compounds Organic oxoazanium compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | 2-nitronaphthalene - Nitroaromatic compound - Organic nitro compound - C-nitro compound - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic oxoazanium - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as nitronaphthalenes. These are polycyclic aromatic compounds containing a naphthalene moiety substituted by one or more nitro groups. |
| External Descriptors | mononitronaphthalene |
| Sensibilidad | Light sensitive |
|---|---|
| Peso molecular | 173.170 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 173.048 Da |
| Monoisotopic Mass | 173.048 Da |
| Topological Polar Surface Area | 45.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 200.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Feng Xu, Zhiquan Chen, Lei Ni, Gang Fu, Jian Liu, Juncheng Jiang. (2023) Study on Continuous Flow Nitration of Naphthalene. ORGANIC PROCESS RESEARCH & DEVELOPMENT, [PMID:] [10.1021/acs.oprd.3c00282] |
| 2. Ruomu Chen, Yumeng Niu, Nan Li, Jingrui Peng, Ziqian Xia, Chenyang Wang, Jiandong Jiang, Kai Chen. (2026) Molecular basis of 1-nitronaphthalene and 2-nitronaphthalene biodegradation by Burkholderia pseudomultivorans M3 and its bioremediation potential. JOURNAL OF HAZARDOUS MATERIALS, [PMID:42546654] [10.1016/j.jhazmat.2026.143131] |