Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CNCCC12C(=O)NC(=N2)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | 2-phenyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| InChIKey | ZQAIBJWZGMSZSG-UHFFFAOYSA-N |
| INCHI | 1S/C13H15N3O/c17-12-13(6-8-14-9-7-13)16-11(15-12)10-4-2-1-3-5-10/h1-5,14H,6-9H2,(H,15,16,17) |
| Isómeros SMILES | C1CNCCC12C(=O)NC(=N2)C3=CC=CC=C3 |
| PubChem CID | 21102147 |
| Peso molecular | 229.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Azaspirodecane derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azaspirodecane derivatives |
| Alternative Parents | Alpha amino acids and derivatives Piperidines Imidazolinones Benzene and substituted derivatives Propargyl-type 1,3-dipolar organic compounds Dialkylamines Carboximidamides Carboxamidines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Alpha-amino acid or derivatives - Azaspirodecane - Monocyclic benzene moiety - Imidazolinone - Piperidine - Benzenoid - 2-imidazoline - Amino acid or derivatives - Amidine - Carboxylic acid amidine - Carboxylic acid derivative - Secondary aliphatic amine - Azacycle - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Secondary amine - Carboximidamide - Amine - Organic oxygen compound - Organic oxide - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as azaspirodecane derivatives. These are organic compounds containing a spirodecane moiety with at least one nitrogen atom. |
| External Descriptors | Not available |
| Peso molecular | 229.280 g/mol |
|---|---|
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 229.122 Da |
| Monoisotopic Mass | 229.122 Da |
| Topological Polar Surface Area | 53.500 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 339.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |