Determine the necessary mass, volume, or concentration for preparing a solution.
Disponible para pedir
GRADE & PURITY ≥97%
Storage
Store at -20°C,Argon charged
Shipped In
Ice chest + Ice pads
| Sonrisas canónicas | C1=CC=C(C(=C1)C=O)C2=CC=NC=C2 |
|---|---|
| IUPAC Name | 2-pyridin-4-ylbenzaldehyde |
| InChIKey | HPSCYFZOYJSYGZ-UHFFFAOYSA-N |
| INCHI | 1S/C12H9NO/c14-9-11-3-1-2-4-12(11)10-5-7-13-8-6-10/h1-9H |
| Isómeros SMILES | C1=CC=C(C(=C1)C=O)C2=CC=NC=C2 |
| CAS alternativo | 176526-00-4 |
| PubChem CID | 642850 |
| Peso molecular | 183.21 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | Phenylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyridines |
| Alternative Parents | Benzoyl derivatives Benzaldehydes Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 4-phenylpyridine - Benzaldehyde - Benzoyl - Aryl-aldehyde - Benzenoid - Monocyclic benzene moiety - Heteroaromatic compound - Azacycle - Hydrocarbon derivative - Aldehyde - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Organic oxide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylpyridines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyridine ring through a CC or CN bond. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Mar 10, 2025 | B698586 | |
| Certificate of Analysis | Mar 10, 2025 | B698586 | |
| Certificate of Analysis | Mar 10, 2025 | B698586 | |
| Certificate of Analysis | Mar 10, 2025 | B698586 |
| Peso molecular | 183.210 g/mol |
|---|---|
| XLogP3 | 1.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 183.068 Da |
| Monoisotopic Mass | 183.068 Da |
| Topological Polar Surface Area | 30.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 187.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |