Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | -2 |
|---|
| Sonrisas canónicas | CC(C)C(C(C(=O)O)N)O |
|---|---|
| IUPAC Name | (2S,3S)-2-amino-3-hydroxy-4-methylpentanoic acid |
| InChIKey | ZAYJDMWJYCTABM-WHFBIAKZSA-N |
| INCHI | 1S/C6H13NO3/c1-3(2)5(8)4(7)6(9)10/h3-5,8H,7H2,1-2H3,(H,9,10)/t4-,5-/m0/s1 |
| Isómeros SMILES | CC(C)[C@@H]([C@@H](C(=O)O)N)O |
| Peso molecular | 147.17 |
| Reaxy-Rn | 1759483 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1759483&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Leucine and derivatives |
| Alternative Parents | L-alpha-amino acids Short-chain hydroxy acids and derivatives Beta hydroxy acids and derivatives Hydroxy fatty acids Methyl-branched fatty acids Secondary alcohols Amino acids Carboxylic acid salts Carboxylic acids Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives Organopnictogen compounds Organic salts Carbonyl compounds Organic zwitterions Monoalkylamines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Leucine or derivatives - Alpha-amino acid - L-alpha-amino acid - Beta-hydroxy acid - Branched fatty acid - Hydroxy fatty acid - Short-chain hydroxy acid - Methyl-branched fatty acid - Hydroxy acid - Fatty acyl - Fatty acid - Carboxylic acid salt - Amino acid - Secondary alcohol - Carboxylic acid - Monocarboxylic acid or derivatives - Organooxygen compound - Organonitrogen compound - Organic salt - Primary aliphatic amine - Organic oxide - Organic zwitterion - Alcohol - Carbonyl group - Organopnictogen compound - Organic oxygen compound - Amine - Hydrocarbon derivative - Primary amine - Organic nitrogen compound - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as leucine and derivatives. These are compounds containing leucine or a derivative thereof resulting from reaction of leucine at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | Not available |
| Peso molecular | 147.170 g/mol |
|---|---|
| XLogP3 | -2.000 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 147.09 Da |
| Monoisotopic Mass | 147.09 Da |
| Topological Polar Surface Area | 83.600 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 124.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |