Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504772135 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504772135 |
| Sonrisas canónicas | C1CC(NCC1NOCC2=CC=CC=C2)C(=O)N |
| IUPAC Name | (2S,5R)-5-(phenylmethoxyamino)piperidine-2-carboxamide |
| InChIKey | OWIVQKMLPQEEGV-NEPJUHHUSA-N |
| INCHI | 1S/C13H19N3O2/c14-13(17)12-7-6-11(8-15-12)16-18-9-10-4-2-1-3-5-10/h1-5,11-12,15-16H,6-9H2,(H2,14,17)/t11-,12+/m1/s1 |
| Isómeros SMILES | C1C[C@H](NC[C@@H]1NOCC2=CC=CC=C2)C(=O)N |
| PubChem CID | 71474579 |
| Peso molecular | 249.31 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid amides |
| Alternative Parents | Piperidinecarboxamides Benzene and substituted derivatives Primary carboxylic acid amides N-organohydroxylamines Dialkylamines Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alpha-amino acid amide - 2-piperidinecarboxamide - Piperidinecarboxamide - Monocyclic benzene moiety - Piperidine - Benzenoid - Carboxamide group - Primary carboxylic acid amide - Secondary amine - Azacycle - Secondary aliphatic amine - N-organohydroxylamine - Organoheterocyclic compound - Amine - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Carbonyl group - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acid amides. These are amide derivatives of alpha amino acids. |
| External Descriptors | Not available |
| Peso molecular | 249.310 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 249.148 Da |
| Monoisotopic Mass | 249.148 Da |
| Topological Polar Surface Area | 76.400 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 267.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Guangdong Sun, Xiuling He, Meilin Feng, Xia Xu, Jine Chen, Yongqiang Wang. (2023) Flavin mononucleotide in visible light photoinitiating systems for multiple-photocrosslinking and photoencapsulation strategies. Acta Biomaterialia, [PMID:37797710] [10.1016/j.actbio.2023.09.051] |
| 2. Liu Qingju, Han Ping, Gong Wenwen, Wang Hui, Feng Xiaoyuan. (2018) Colorimetric determination of the pesticide chlorothalonil based on the aggregation of gold nanoparticles. MICROCHIMICA ACTA, 185 (7): (1-7). [PMID:29971610] [10.1007/s00604-018-2890-7] |