≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[Si]1(CCCN1[Si](C)(C)CCCN)C |
|---|---|
| IUPAC Name | 3-[(2,2-dimethylazasilolidin-1-yl)-dimethylsilyl]propan-1-amine |
| InChIKey | IELVEAVYQVBGNX-UHFFFAOYSA-N |
| INCHI | 1S/C10H26N2Si2/c1-13(2,9-5-7-11)12-8-6-10-14(12,3)4/h5-11H2,1-4H3 |
| Peso molecular | 230.500 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Organoheterosilanes |
| Direct Parent | Trialkylheterosilanes |
| Alternative Parents | Organic metalloid salts N-silyl compounds Azacyclic compounds Organopnictogen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Trialkylheterosilane - N-silyl compound - Azacycle - Organic metalloid salt - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic salt - Primary amine - Organonitrogen compound - Primary aliphatic amine - Amine - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trialkylheterosilanes. These are organoheterosilanes, bearing a silicon atom linked to three alkyl groups and one heteroatom. |
| External Descriptors | Not available |
| Peso molecular | 230.500 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 4 |
| Exact Mass | 230.163 Da |
| Monoisotopic Mass | 230.163 Da |
| Topological Polar Surface Area | 29.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 193.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![3-[(2,2-Dimethyl-1-aza-2-silacyclopent-1-yl)dimethylsilyl]-1-propanamine - ≥95% , CAS No.388606-32-4](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)