Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC(=C(C=C1Cl)Cl)CNCC(C(F)(F)F)O |
|---|---|
| IUPAC Name | 3-[(2,4-dichlorophenyl)methylamino]-1,1,1-trifluoropropan-2-ol |
| InChIKey | MJEADNLRSYFUMN-UHFFFAOYSA-N |
| INCHI | 1S/C10H10Cl2F3NO/c11-7-2-1-6(8(12)3-7)4-16-5-9(17)10(13,14)15/h1-3,9,16-17H,4-5H2 |
| Isómeros SMILES | C1=CC(=C(C=C1Cl)Cl)CNCC(C(F)(F)F)O |
| PubChem CID | 3779629 |
| Peso molecular | 288.1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Phenylmethylamines Benzylamines Aralkylamines Aryl chlorides Secondary alcohols Fluorohydrins 1,2-aminoalcohols Dialkylamines Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzylamine - 1,3-dichlorobenzene - Phenylmethylamine - Aralkylamine - Aryl chloride - Aryl halide - Secondary alcohol - 1,2-aminoalcohol - Fluorohydrin - Halohydrin - Secondary amine - Secondary aliphatic amine - Hydrocarbon derivative - Organohalogen compound - Organochloride - Organic oxygen compound - Organofluoride - Organic nitrogen compound - Alcohol - Organonitrogen compound - Amine - Alkyl halide - Alkyl fluoride - Organooxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
| Peso molecular | 288.090 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 287.009 Da |
| Monoisotopic Mass | 287.009 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 240.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |