Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1(CC([N+](=C1)[O-])(C)C)C |
|---|---|
| IUPAC Name | 2,2,4,4-tetramethyl-1-oxido-3H-pyrrol-1-ium |
| InChIKey | GUQARRULARNYQZ-UHFFFAOYSA-N |
| INCHI | 1S/C8H15NO/c1-7(2)5-8(3,4)9(10)6-7/h6H,5H2,1-4H3 |
| Isómeros SMILES | CC1(CC([N+](=C1)[O-])(C)C)C |
| WGK Alemania | 3 |
| PubChem CID | 151490 |
| Peso molecular | 141.21 |
| Beilstein | 20(3/4)1977 |
| Reaxy-Rn | 111506 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyrrolines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyrrolines |
| Alternative Parents | Nitrones Propargyl-type 1,3-dipolar organic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Pyrroline - Nitrone - Azacycle - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Allyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as pyrrolines. These are compounds containing a pyrroline ring, which is a five-member unsaturated aliphatic ring with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
| Sensibilidad | Light Sensitive,Hygroscopic,Heat Sensitive |
|---|---|
| Punto de ebullición (°C) | 73 °C/1 mmHg |
| Punto de fusión (°C) | 61 °C |
| Peso molecular | 141.210 g/mol |
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 141.115 Da |
| Monoisotopic Mass | 141.115 Da |
| Topological Polar Surface Area | 28.800 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 180.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yang Zhao, Biao Ma, Xiaomei Liu, Ning Li, Yang Li, Xiaobin Fan, Wenchao Peng. (2023) Microwave and template assisted synthesis of atomically dispersed Co–N2 sites on carbon spheres for Fenton-like reaction. CARBON, [PMID:] [10.1016/j.carbon.2023.118371] |