Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(SCCC(=O)O)SCCC(=O)O |
|---|---|
| IUPAC Name | 3-[2-(2-carboxyethylsulfanyl)propan-2-ylsulfanyl]propanoic acid |
| InChIKey | QMHSRLRLGYJODR-UHFFFAOYSA-N |
| INCHI | 1S/C9H16O4S2/c1-9(2,14-5-3-7(10)11)15-6-4-8(12)13/h3-6H2,1-2H3,(H,10,11)(H,12,13) |
| Isómeros SMILES | CC(C)(SCCC(=O)O)SCCC(=O)O |
| PubChem CID | 248457 |
| Peso molecular | 252.35 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Clase | Thioacetals |
| Subclass | Dithioacetals |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Dithioketals |
| Alternative Parents | Fatty acids and conjugates Dicarboxylic acids and derivatives Sulfenyl compounds Dialkylthioethers Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Dithioketal - Fatty acid - Dicarboxylic acid or derivatives - Dialkylthioether - Sulfenyl compound - Thioether - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dithioketals. These are compounds containing a dithioketal functional group with the general structure R2C(SR')2 with R, R' = organyl. |
| External Descriptors | Not available |
| Peso molecular | 252.400 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 8 |
| Exact Mass | 252.049 Da |
| Monoisotopic Mass | 252.049 Da |
| Topological Polar Surface Area | 125.000 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 206.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yu Chen, Zhentan Lu, Dong Wang. (2024) Multifunctional Nanoplatform for Single NIR Laser-Regulated Efficient PDT/PTT/Chemotherapy. BIOMACROMOLECULES, [PMID:38242167] [10.1021/acs.biomac.3c01100] |
| 2. Yu Chen, Zhentan Lu, Dong Wang. (2026) Mitochondrial Targeted Composite Nanoplatform Activated by a Single NIR Laser for Enhanced Synergistic PTT, PDT, and Chemotherapy. BIOMACROMOLECULES, [PMID:41664484] [10.1021/acs.biomac.5c02643] |