≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CN1C(=O)CCC(C1=O)N2CC3=C(C2=O)C=CC=C3N |
|---|---|
| IUPAC Name | 3-(7-amino-3-oxo-1H-isoindol-2-yl)-1-methylpiperidine-2,6-dione |
| InChIKey | BFAKEGSEMVIKLE-UHFFFAOYSA-N |
| INCHI | 1S/C14H15N3O3/c1-16-12(18)6-5-11(14(16)20)17-7-9-8(13(17)19)3-2-4-10(9)15/h2-4,11H,5-7,15H2,1H3 |
| Isómeros SMILES | CN1C(=O)CCC(C1=O)N2CC3=C(C2=O)C=CC=C3N |
| PubChem CID | 59809876 |
| Peso molecular | 273.29 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Isoindoles and derivatives |
| Subclass | Isoindolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isoindolones |
| Alternative Parents | Alpha amino acids and derivatives Piperidinediones Delta lactams N-substituted carboxylic acid imides N-acyl amines Benzenoids Tertiary carboxylic acid amides Pyrrolines Dicarboximides Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isoindolone - Alpha-amino acid or derivatives - Piperidinedione - Piperidinone - Delta-lactam - Benzenoid - Piperidine - Carboxylic acid imide, n-substituted - N-acyl-amine - Tertiary carboxylic acid amide - Pyrroline - Dicarboximide - Carboxylic acid imide - Lactam - Carboxamide group - Amino acid or derivatives - Azacycle - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Primary amine - Organooxygen compound - Organonitrogen compound - Primary aliphatic amine - Amine - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as isoindolones. These are aromatic polycyclic compounds that an isoindole bearing a ketone. |
| External Descriptors | Not available |
| Peso molecular | 273.290 g/mol |
|---|---|
| XLogP3 | -0.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 273.111 Da |
| Monoisotopic Mass | 273.111 Da |
| Topological Polar Surface Area | 83.700 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 465.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
