Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[Si](C)(C)C1=C(C(=C(S1)[Si](C)(C)C)F)F |
|---|---|
| IUPAC Name | (3,4-difluoro-5-trimethylsilylthiophen-2-yl)-trimethylsilane |
| InChIKey | BIIDYHMAKPKADL-UHFFFAOYSA-N |
| INCHI | 1S/C10H18F2SSi2/c1-14(2,3)9-7(11)8(12)10(13-9)15(4,5)6/h1-6H3 |
| Isómeros SMILES | C[Si](C)(C)C1=C(C(=C(S1)[Si](C)(C)C)F)F |
| Peso molecular | 264.48 |
| Reaxy-Rn | 9055321 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=9055321&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Clase | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | Aryl fluorides Thiophenes Heteroaromatic compounds Organic metalloid salts Organofluorides Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Alkylarylsilane - Aryl halide - Aryl fluoride - Heteroaromatic compound - Thiophene - Organic metalloid salt - Organoheterocyclic compound - Hydrocarbon derivative - Alkylsilane - Organofluoride - Organohalogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
| Sensibilidad | Air Sensitive,Heat Sensitive |
|---|---|
| Índice de refracción | 1.47 |
| Punto de inflamación (°C) | 72 °C |
| Punto de ebullición (°C) | 98°C/8mmHg(lit.) |
| Peso molecular | 264.480 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 264.064 Da |
| Monoisotopic Mass | 264.064 Da |
| Topological Polar Surface Area | 28.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 211.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |