≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504758023 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504758023 |
| Sonrisas canónicas | C1=CC2=C(C=C1Cl)C3=C(N2)C=CC(=C3)Cl |
| IUPAC Name | 3,6-dichloro-9H-carbazole |
| InChIKey | BIMDTNQPZWJKPL-UHFFFAOYSA-N |
| INCHI | 1S/C12H7Cl2N/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,15H |
| Isómeros SMILES | C1=CC2=C(C=C1Cl)C3=C(N2)C=CC(=C3)Cl |
| Peso molecular | 236.1 |
| Beilstein | 20(5)8,49 |
| Reaxy-Rn | 170461 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=170461&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Indoles and derivatives |
| Subclass | Carbazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carbazoles |
| Alternative Parents | Indoles Benzenoids Aryl chlorides Pyrroles Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Carbazole - Indole - Benzenoid - Aryl halide - Aryl chloride - Heteroaromatic compound - Pyrrole - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as carbazoles. These are compounds containing a three ring system containing a pyrrole ring fused on either side to a benzene ring. |
| External Descriptors | Not available |
| Solubilidad | Soluble in Acetone |
|---|---|
| Punto de fusión (°C) | 208 °C |
| Peso molecular | 236.090 g/mol |
| XLogP3 | 5.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 234.996 Da |
| Monoisotopic Mass | 234.996 Da |
| Topological Polar Surface Area | 15.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yanke Lu, Pengfei Li, Liuliu Cheng, Lianfeng Ai, Jiankun Cao, Hongyuan Yan. (2024) Chitosan-glutaraldehyde graphene oxide aerogel for extraction of polybrominated and -chlorinated carbazoles in lotus root. FOOD CHEMISTRY, [PMID:39608039] [10.1016/j.foodchem.2024.142132] |
A2226058