Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1COC2=C(O1)C=CC(=C2)C(=O)C3=CC(=CC=C3)N |
|---|---|
| IUPAC Name | (3-aminophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanone |
| InChIKey | CGYQQXGDGASFPI-UHFFFAOYSA-N |
| INCHI | 1S/C15H13NO3/c16-12-3-1-2-10(8-12)15(17)11-4-5-13-14(9-11)19-7-6-18-13/h1-5,8-9H,6-7,16H2 |
| Isómeros SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)C3=CC(=CC=C3)N |
| PubChem CID | 39357254 |
| Peso molecular | 255.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzophenones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzophenones |
| Alternative Parents | Aryl-phenylketones Benzo-1,4-dioxanes Benzoyl derivatives Aniline and substituted anilines Alkyl aryl ethers Para dioxins Oxacyclic compounds Primary amines Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzophenone - Aryl-phenylketone - Benzo-1,4-dioxane - Benzodioxane - Benzoyl - Aniline or substituted anilines - Aryl ketone - Alkyl aryl ether - Para-dioxin - Ketone - Ether - Oxacycle - Organoheterocyclic compound - Primary amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Amine - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzophenones. These are organic compounds containing a ketone attached to two phenyl groups. |
| External Descriptors | Not available |
| Peso molecular | 255.270 g/mol |
|---|---|
| XLogP3 | 1.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 255.09 Da |
| Monoisotopic Mass | 255.09 Da |
| Topological Polar Surface Area | 61.600 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 333.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |