Determine the necessary mass, volume, or concentration for preparing a solution.
≥95%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C,Argon charged Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504765852 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504765852 |
| Sonrisas canónicas | CC(C)[Si](C(C)C)(C(C)C)N1C=C(C2=CC=CC=C21)Br |
| IUPAC Name | (3-bromoindol-1-yl)-tri(propan-2-yl)silane |
| InChIKey | VELAHBNAGHGPNP-UHFFFAOYSA-N |
| INCHI | 1S/C17H26BrNSi/c1-12(2)20(13(3)4,14(5)6)19-11-16(18)15-9-7-8-10-17(15)19/h7-14H,1-6H3 |
| Isómeros SMILES | CC(C)[Si](C(C)C)(C(C)C)N1C=C(C2=CC=CC=C21)Br |
| Peso molecular | 352.39 |
| Reaxy-Rn | 6331619 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6331619&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Indoles and derivatives |
| Subclass | Indoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indoles |
| Alternative Parents | Alkylarylsilanes Substituted pyrroles Benzenoids Aryl bromides Trialkylheterosilanes Heteroaromatic compounds Organic metalloid salts N-silyl compounds Azacyclic compounds Organonitrogen compounds Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indole - Alkylarylsilane - Aryl bromide - Aryl halide - Substituted pyrrole - Benzenoid - Trialkylheterosilane - Pyrrole - Heteroaromatic compound - Organoheterosilane - N-silyl compound - Organic metalloid salt - Azacycle - Organosilicon compound - Hydrocarbon derivative - Organic nitrogen compound - Organonitrogen compound - Organobromide - Organic metalloid moeity - Organohalogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as indoles. These are compounds containing an indole moiety, which consists of pyrrole ring fused to benzene to form 2,3-benzopyrrole. |
| External Descriptors | Not available |
| Sensibilidad | Sensitive to air, sensitive to light, and sensitive to heat |
|---|---|
| Punto de fusión (°C) | 65 °C |
| Peso molecular | 352.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 4 |
| Exact Mass | 351.102 Da |
| Monoisotopic Mass | 351.102 Da |
| Topological Polar Surface Area | 4.900 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 307.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |