Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[N+](C)(C)CCCNS(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.[I-] |
|---|---|
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonylamino)propyl-trimethylazanium;iodide |
| InChIKey | MLIMEVJPZQAQQE-UHFFFAOYSA-M |
| INCHI | 1S/C14H16F17N2O2S.HI/c1-33(2,3)6-4-5-32-36(34,35)14(30,31)12(25,26)10(21,22)8(17,18)7(15,16)9(19,20)11(23,24)13(27,28)29;/h32H,4-6H2,1-3H3;1H/q+1;/p-1 |
| Isómeros SMILES | C[N+](C)(C)CCCNS(=O)(=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F.[I-] |
| PubChem CID | 84096 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Clase | Alkyl halides |
| Subclass | Alkyl fluorides |
| Intermediate Tree Nodes | Perfluoroalkyl sulfonic acid and derivatives |
| Direct Parent | Perfluorooctane sulfonic acid and derivatives |
| Alternative Parents | Organosulfonamides Organic sulfonamides Tetraalkylammonium salts Aminosulfonyl compounds Organopnictogen compounds Organofluorides Organic oxides Organic iodide salts Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Perfluorooctane sulfonic acid or derivatives - Organic sulfonic acid amide - Organosulfonic acid amide - Quaternary ammonium salt - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Aminosulfonyl compound - Tetraalkylammonium salt - Organosulfur compound - Organonitrogen compound - Organic oxygen compound - Organofluoride - Organic nitrogen compound - Amine - Organic salt - Organic iodide salt - Organopnictogen compound - Hydrocarbon derivative - Organic oxide - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as perfluorooctane sulfonic acid and derivatives. These are organic compounds containing an octyl chain attached to the sulfur of a sulfonic acid (or a derivative thereof), where all hydrogens of the octyl chain are replaced by fluorine atoms. |
| External Descriptors | Not available |
| Peso molecular | 726.230 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 21 |
| Rotatable Bond Count | 12 |
| Exact Mass | 725.971 Da |
| Monoisotopic Mass | 725.971 Da |
| Topological Polar Surface Area | 54.600 Ų |
| Heavy Atom Count | 37 |
| Formal Charge | 0 |
| Complexity | 885.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |