Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1COCCN1C(=O)C2=CC3=CC=CC=C3C(=O)S2 |
|---|---|
| IUPAC Name | 3-(morpholine-4-carbonyl)isothiochromen-1-one |
| InChIKey | ZBMRFYXOBATPTC-UHFFFAOYSA-N |
| INCHI | 1S/C14H13NO3S/c16-13(15-5-7-18-8-6-15)12-9-10-3-1-2-4-11(10)14(17)19-12/h1-4,9H,5-8H2 |
| Peso molecular | 275.320 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Isothiochromenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isothiochromenes |
| Alternative Parents | Morpholine carboxylic acids and derivatives 2-benzothiopyrans 2-heteroaryl carboxamides Benzenoids Tertiary carboxylic acid amides Heteroaromatic compounds Carbothioic S-lactones Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isothiochromene - Morpholine-4-carboxylic acid or derivatives - Benzothiopyran - 2-benzothiopyran - 2-heteroaryl carboxamide - Morpholine - Oxazinane - Benzenoid - Carbothioic s-lactone - Tertiary carboxylic acid amide - Heteroaromatic compound - Carboxamide group - Oxacycle - Azacycle - Carboxylic acid derivative - Ether - Dialkyl ether - Organic oxide - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as isothiochromenes. These are organic heterocyclic compounds containing an isothiochromene moiety. |
| External Descriptors | Not available |
| Peso molecular | 275.320 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 275.062 Da |
| Monoisotopic Mass | 275.062 Da |
| Topological Polar Surface Area | 71.900 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 415.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |