Determine the necessary mass, volume, or concentration for preparing a solution.
| Activity Type | Activity Value -log(M) | Mechanism of Action | Activity Reference | Publications (PubMed IDs) |
|---|
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 6 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
3-Phenoxybenzoic acid are used to control a wide range of insects in public and commercial buildings, animal facilities, warehouses, agricultural fields, and greenhouses. They are also applied on livestock to control insects. In agriculture, cypermethrin, cyfluthrin, and deltamethrin have been used frequently on cotton. It is generally formulated as complex mixtures of different chemical isomers, solvent oils, and synergists.
| Pubchem Sid | 528759278 |
|---|---|
| Sonrisas canónicas | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)O |
| IUPAC Name | 3-phenoxybenzoic acid |
| InChIKey | NXTDJHZGHOFSQG-UHFFFAOYSA-N |
| INCHI | 1S/C13H10O3/c14-13(15)10-5-4-8-12(9-10)16-11-6-2-1-3-7-11/h1-9H,(H,14,15) |
| Isómeros SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)C(=O)O |
| RTECS | DH6293500 |
| PubChem CID | 19539 |
| Peso molecular | 214.22 |
| Beilstein | 10138 |
| Reaxy-Rn | 2105574 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Diphenylethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylethers |
| Alternative Parents | Diarylethers Benzoic acids Phenoxy compounds Phenol ethers Benzoyl derivatives Monocarboxylic acids and derivatives Carboxylic acids Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylether - Diaryl ether - Benzoic acid or derivatives - Benzoic acid - Phenoxy compound - Benzoyl - Phenol ether - Carboxylic acid derivative - Carboxylic acid - Ether - Monocarboxylic acid or derivatives - Organic oxygen compound - Organooxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diphenylethers. These are aromatic compounds containing two benzene rings linked to each other through an ether group. |
| External Descriptors | phenoxybenzoic acid |
| Activity Type | Activity Value -log(M) | Mechanism of Action | Activity Reference | Publications (PubMed IDs) |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Punto de fusión (°C) | 147 °C |
|---|---|
| Peso molecular | 214.220 g/mol |
| XLogP3 | 3.900 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 214.063 Da |
| Monoisotopic Mass | 214.063 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 233.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yiwen Cui, Yingying Sun, Hang Yu, Yahui Guo, Weirong Yao, Yunfei Xie, Fangwei Yang. (2023) Exploring the binding mechanism and adverse toxic effects of degradation metabolites of pyrethroid insecticides to human serum albumin: Multi-spectroscopy, calorimetric and molecular docking approaches. FOOD AND CHEMICAL TOXICOLOGY, [PMID:37479174] [10.1016/j.fct.2023.113951] |
| 2. Yongna Zhao, Dandan Du, Qiannan Li, Wenjie Chen, Qingchen Li, Qingzhu Zhang, Ning Liang. (2020) Dummy-surface molecularly imprinted polymers based on magnetic graphene oxide for selective extraction and quantification of pyrethroids pesticides in fruit juices. MICROCHEMICAL JOURNAL, [PMID:] [10.1016/j.microc.2020.105411] |
| 3. Keke Yang, Hou Bo, Dewei Ma, Mingwei Peng, Qinglong Liu, Ziwen Heng, Zhongwei Gu, Xuhan Liu, Siyuan Chen. (2024) pH and glucose dual-responsive phenylboronic acid hydrogels for smart insulin delivery. Soft Matter, [PMID:39474819] [10.1039/D4SM01004C] |
| 4. Sifang Zhao, Fengjiao Chen, Xianwu Chen, Hongze Liang, Hui Tan, Lingling Zhao. (2024) Phenylboronic Acid-Modified pH/Glucose Dual-Responsive Polymeric Micelles for Targeted Anticancer Drug Delivery. ACS Applied Nano Materials, [PMID:] [10.1021/acsanm.4c04679] |
| 5. Li Ming, Yongfei Zhou, Ning Li, Xinhua Zhou, Hongyan Zhang, Xiaobo Zou, Can Zhang. (2025) Nanozyme-amplified lateral flow nanobody-immunoassay via PEI-mediated coupling strategy for sensitive detection of 3-phenoxybenzoic acid. Food Bioscience, [PMID:] [10.1016/j.fbio.2025.107611] |
| 6. Jin Meng, Ning Qiong, Zhang Mengping, Wei Haiyan, Meng Xiao, Chen Wenwen, Pan Hui, Xiu Haidi, Liu Lisheng, Wang Cuijuan. (2026) A ready-to-use microsensor based on SERS technique for deltamethrin and its metabolite determination toward point-of-care diagnostics. MICROCHIMICA ACTA, 193 (3): (131). [PMID:41642409] [10.1007/s00604-025-07829-z] |