≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=O)C1C(=O)CC[N-]C1=O.[Na+] |
|---|---|
| IUPAC Name | sodium;methyl 2,4-dioxopiperidin-1-ide-3-carboxylate |
| InChIKey | DDRNHSMNCKFPEI-UHFFFAOYSA-M |
| INCHI | 1S/C7H9NO4.Na/c1-12-7(11)5-4(9)2-3-8-6(5)10;/h5H,2-3H2,1H3,(H,8,10);/q;+1/p-1 |
| Isómeros SMILES | COC(=O)C1C(=O)CC[N-]C1=O.[Na+] |
| CAS alternativo | 139122-78-4 |
| PubChem CID | 24820192 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Piperidinediones Delta lactams 1,3-dicarbonyl compounds Methyl esters Cyclic ketones Monocarboxylic acids and derivatives Carbene-type 1,3-dipolar compounds Azacyclic compounds Organonitrogen compounds Organic sodium salts Organic oxides Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Piperidinecarboxylic acid - Piperidinedione - Delta-lactam - Piperidinone - 1,3-dicarbonyl compound - Methyl ester - Carboxylic acid ester - Ketone - Lactam - Cyclic ketone - Organic 1,3-dipolar compound - Carbene-type 1,3-dipolar compound - Organic alkali metal salt - Azacycle - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Organic sodium salt - Organic salt - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organic oxide - Hydrocarbon derivative - Carbonyl group - Organic nitrogen compound - Organic cation - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
| Peso molecular | 193.130 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 193.035 Da |
| Monoisotopic Mass | 193.035 Da |
| Topological Polar Surface Area | 61.400 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 241.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
