Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CNCCN(C1)C2=NC=CC3=C2C=CO3 |
|---|---|
| IUPAC Name | 4-(1,4-diazepan-1-yl)furo[3,2-c]pyridine |
| InChIKey | JGVLLHBTSVQMHS-UHFFFAOYSA-N |
| INCHI | 1S/C12H15N3O/c1-4-13-6-8-15(7-1)12-10-3-9-16-11(10)2-5-14-12/h2-3,5,9,13H,1,4,6-8H2 |
| Isómeros SMILES | C1CNCCN(C1)C2=NC=CC3=C2C=CO3 |
| PubChem CID | 2794809 |
| Peso molecular | 217.27 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Furopyridines |
| Subclass | Furo[3,2-c]pyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Furo[3,2-c]pyridines |
| Alternative Parents | Dialkylarylamines Aminopyridines and derivatives 1,4-diazepanes Imidolactams Heteroaromatic compounds Furans Oxacyclic compounds Dialkylamines Azacyclic compounds Organopnictogen compounds Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Furo[3,2-c]pyridine - Dialkylarylamine - 1,4-diazepane - Aminopyridine - Diazepane - Pyridine - Imidolactam - Furan - Heteroaromatic compound - Secondary amine - Secondary aliphatic amine - Oxacycle - Azacycle - Amine - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as furo[3,2-c]pyridines. These are aromatic compounds containing a furopyridine ring system, where the O- and the N-atom are at the 1- and 5- position, respectively. |
| External Descriptors | Not available |
| Peso molecular | 217.270 g/mol |
|---|---|
| XLogP3 | 1.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 217.122 Da |
| Monoisotopic Mass | 217.122 Da |
| Topological Polar Surface Area | 41.300 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 236.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |