Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C(C(=C1)C2=NOC(=C2C#N)C=CNC3=CC=C(C=C3)C(=O)O)Cl |
|---|---|
| IUPAC Name | 4-[[(E)-2-[3-(2-chlorophenyl)-4-cyano-1,2-oxazol-5-yl]ethenyl]amino]benzoic acid |
| InChIKey | XGQJEIMAAQBFET-MDZDMXLPSA-N |
| INCHI | 1S/C19H12ClN3O3/c20-16-4-2-1-3-14(16)18-15(11-21)17(26-23-18)9-10-22-13-7-5-12(6-8-13)19(24)25/h1-10,22H,(H,24,25)/b10-9+ |
| Isómeros SMILES | C1=CC=C(C(=C1)C2=NOC(=C2C#N)/C=C/NC3=CC=C(C=C3)C(=O)O)Cl |
| PubChem CID | 5524143 |
| Peso molecular | 365.78 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Aminobenzoic acids and derivatives |
| Direct Parent | Aminobenzoic acids |
| Alternative Parents | Benzoic acids Aniline and substituted anilines Benzoyl derivatives Chlorobenzenes Aryl chlorides Isoxazoles Heteroaromatic compounds Amino acids Secondary amines Oxacyclic compounds Azacyclic compounds Nitriles Monocarboxylic acids and derivatives Enamines Carboxylic acids Hydrocarbon derivatives Organic oxides Organochlorides Organooxygen compounds Organopnictogen compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aminobenzoic acid - Benzoic acid - Benzoyl - Aniline or substituted anilines - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Azole - Heteroaromatic compound - Isoxazole - Amino acid or derivatives - Amino acid - Oxacycle - Carboxylic acid derivative - Carboxylic acid - Azacycle - Enamine - Organoheterocyclic compound - Secondary amine - Monocarboxylic acid or derivatives - Carbonitrile - Nitrile - Organic oxygen compound - Organopnictogen compound - Cyanide - Organic oxide - Hydrocarbon derivative - Amine - Organic nitrogen compound - Organohalogen compound - Organochloride - Organonitrogen compound - Organooxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aminobenzoic acids. These are benzoic acids containing an amine group attached to the benzene moiety. |
| External Descriptors | Not available |
| Peso molecular | 365.800 g/mol |
|---|---|
| XLogP3 | 3.900 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 5 |
| Exact Mass | 365.057 Da |
| Monoisotopic Mass | 365.057 Da |
| Topological Polar Surface Area | 99.200 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 568.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |