Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CN(CCN1C2=CC=CC=C2F)C(=O)NC3=CC=CC(=C3)C(F)(F)F |
|---|---|
| IUPAC Name | 4-(2-fluorophenyl)-N-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| InChIKey | OSMOJUVNLNZDJB-UHFFFAOYSA-N |
| INCHI | 1S/C18H17F4N3O/c19-15-6-1-2-7-16(15)24-8-10-25(11-9-24)17(26)23-14-5-3-4-13(12-14)18(20,21)22/h1-7,12H,8-11H2,(H,23,26) |
| Isómeros SMILES | C1CN(CCN1C2=CC=CC=C2F)C(=O)NC3=CC=CC(=C3)C(F)(F)F |
| PubChem CID | 3360340 |
| Peso molecular | 367.35 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Diazinanes |
| Subclass | Piperazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpiperazines |
| Alternative Parents | N-arylpiperazines Trifluoromethylbenzenes N-phenylureas Piperazine carboxamides Dialkylarylamines Aniline and substituted anilines Fluorobenzenes Aryl fluorides Ureas Azacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Phenylpiperazine - N-arylpiperazine - N-phenylurea - Trifluoromethylbenzene - Piperazine-1-carboxamide - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Fluorobenzene - Halobenzene - Benzenoid - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Urea - Tertiary amine - Azacycle - Hydrocarbon derivative - Organofluoride - Organohalogen compound - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Carbonyl group - Organic oxygen compound - Organic oxide - Alkyl fluoride - Alkyl halide - Amine - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylpiperazines. These are compounds containing a phenylpiperazine skeleton, which consists of a piperazine bound to a phenyl group. |
| External Descriptors | Not available |
| Peso molecular | 367.300 g/mol |
|---|---|
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 367.131 Da |
| Monoisotopic Mass | 367.131 Da |
| Topological Polar Surface Area | 35.600 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 480.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |