Determine the necessary mass, volume, or concentration for preparing a solution.
≥96% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | B(C1=CC=C(C=C1)C(=O)N2CCCC(C2)C(=O)OCC)(O)O |
|---|---|
| IUPAC Name | [4-(3-ethoxycarbonylpiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | IXWDVUCXVFXXEN-UHFFFAOYSA-N |
| INCHI | 1S/C15H20BNO5/c1-2-22-15(19)12-4-3-9-17(10-12)14(18)11-5-7-13(8-6-11)16(20)21/h5-8,12,20-21H,2-4,9-10H2,1H3 |
| Isómeros SMILES | B(C1=CC=C(C=C1)C(=O)N2CCCC(C2)C(=O)OCC)(O)O |
| PubChem CID | 46739242 |
| Peso molecular | 305.1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoyl derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1-benzoylpiperidines |
| Alternative Parents | N-benzoylpiperidines Piperidinecarboxylic acids Benzamides Tertiary carboxylic acid amides Tertiary amines Carboxylic acid esters Boronic acids Amino acids and derivatives Organic metalloid salts Monocarboxylic acids and derivatives Azacyclic compounds Organometalloid compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-benzoylpiperidine - 1-benzoylpiperidine - N-acyl-piperidine - Benzamide - Benzoic acid or derivatives - Piperidinecarboxylic acid - Piperidine - Tertiary carboxylic acid amide - Carboxylic acid ester - Amino acid or derivatives - Boronic acid derivative - Carboxamide group - Boronic acid - Tertiary amine - Carboxylic acid derivative - Azacycle - Organic metalloid salt - Monocarboxylic acid or derivatives - Organoheterocyclic compound - Amine - Organic metalloid moeity - Organonitrogen compound - Carbonyl group - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 1-benzoylpiperidines. These are compounds containing a piperidine ring substituted at the 1-position with a benzoyl group. |
| External Descriptors | Not available |
| Peso molecular | 305.140 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Exact Mass | 305.143 Da |
| Monoisotopic Mass | 305.143 Da |
| Topological Polar Surface Area | 87.100 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 395.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |