Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CNCCC(C1=CC=C(C2=CC=CC=C21)O)C3=CC=CS3 |
|---|---|
| IUPAC Name | 4-[3-(methylamino)-1-thiophen-2-ylpropyl]naphthalen-1-ol |
| InChIKey | OJXMJLCWKLPCHB-UHFFFAOYSA-N |
| INCHI | 1S/C18H19NOS/c1-19-11-10-16(18-7-4-12-21-18)14-8-9-17(20)15-6-3-2-5-13(14)15/h2-9,12,16,19-20H,10-11H2,1H3 |
| Isómeros SMILES | CNCCC(C1=CC=C(C2=CC=CC=C21)O)C3=CC=CS3 |
| Peso molecular | 297.42 |
| Reaxy-Rn | 15584761 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15584761&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Naphthalenes |
| Subclass | Naphthols and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthols and derivatives |
| Alternative Parents | Aralkylamines 1-hydroxy-2-unsubstituted benzenoids Thiophenes Heteroaromatic compounds Dialkylamines Organooxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 1-naphthol - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Aralkylamine - Heteroaromatic compound - Thiophene - Secondary aliphatic amine - Organoheterocyclic compound - Secondary amine - Amine - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as naphthols and derivatives. These are naphthalene derivatives carrying one or more hydroxyl (-OH) groups at any ring position. |
| External Descriptors | Not available |
| Peso molecular | 297.400 g/mol |
|---|---|
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 297.119 Da |
| Monoisotopic Mass | 297.119 Da |
| Topological Polar Surface Area | 60.500 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 324.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jin Zhu, Yi He, Lijun Luo, Libo Li, Tianyan You. (2023) Electrochemical Determination of Hazardous Herbicide Diuron Using MWCNTs-CS@NGQDs Composite-Modified Glassy Carbon Electrodes. Biosensors-Basel, 13 (8): (808). [PMID:37622893] [10.3390/bios13080808] |
| 2. Yong Xiang, Chang-Yuan Cheng, Kang-Fei Lu, Wen-Cai Bai, Zhou-Xuan Zang, Li Xu, Guo-Ji Liu. (2025) Ligand removal and metal exchange tailoring of HP-MOFs for gold recovery from electronic waste. SEPARATION AND PURIFICATION TECHNOLOGY, [PMID:] [10.1016/j.seppur.2025.132647] |