Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CS(=O)(=O)CCN1C2=C(C=C(C=C2F)N)F |
|---|---|
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-3,5-difluoroaniline |
| InChIKey | PLZYGAAUYBWQNK-UHFFFAOYSA-N |
| INCHI | 1S/C10H12F2N2O2S/c11-8-5-7(13)6-9(12)10(8)14-1-3-17(15,16)4-2-14/h5-6H,1-4,13H2 |
| Peso molecular | 262.280 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Thiazinanes |
| Subclass | Thiomorpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylthiomorpholines |
| Alternative Parents | Dialkylarylamines Aniline and substituted anilines Fluorobenzenes Aryl fluorides Sulfones Azacyclic compounds Primary amines Organofluorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 4-phenylthiomorpholine - Tertiary aliphatic/aromatic amine - Dialkylarylamine - Aniline or substituted anilines - Fluorobenzene - Halobenzene - Aryl fluoride - Benzenoid - Aryl halide - Monocyclic benzene moiety - Sulfone - Tertiary amine - Azacycle - Primary amine - Organic nitrogen compound - Organonitrogen compound - Organofluoride - Organohalogen compound - Amine - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylthiomorpholines. These are compounds containing a thiomorpholine ring conjugated to a phenyl group. Thiomorpholine a six-membered aliphatic ring containing one nitrogen atom and one sulfur atom at positions 1 and 4 respectively, and four carbon atoms. |
| External Descriptors | Not available |
| Peso molecular | 262.280 g/mol |
|---|---|
| XLogP3 | 0.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 262.059 Da |
| Monoisotopic Mass | 262.059 Da |
| Topological Polar Surface Area | 71.800 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 345.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |