Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CN1CC(C(C1)C(=O)C2=CC=CS2)C3=CC=C(C=C3)Cl |
|---|---|
| IUPAC Name | [4-(4-chlorophenyl)-1-methylpyrrolidin-3-yl]-thiophen-2-ylmethanone |
| InChIKey | DQDLEPZVHJFUCX-UHFFFAOYSA-N |
| INCHI | 1S/C16H16ClNOS/c1-18-9-13(11-4-6-12(17)7-5-11)14(10-18)16(19)15-3-2-8-20-15/h2-8,13-14H,9-10H2,1H3 |
| Isómeros SMILES | CN1CC(C(C1)C(=O)C2=CC=CS2)C3=CC=C(C=C3)Cl |
| PubChem CID | 3815132 |
| Peso molecular | 305.83 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyrrolidines |
| Subclass | Phenylpyrrolidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpyrrolidines |
| Alternative Parents | Aryl alkyl ketones Chlorobenzenes Aralkylamines N-alkylpyrrolidines Gamma-amino ketones Beta-amino ketones Aryl chlorides Thiophenes Pyrroles Heteroaromatic compounds Trialkylamines Azacyclic compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 3-phenylpyrrolidine - Aryl ketone - Aryl alkyl ketone - Chlorobenzene - Halobenzene - Aralkylamine - Aryl chloride - Aryl halide - Monocyclic benzene moiety - Beta-aminoketone - Gamma-aminoketone - N-alkylpyrrolidine - Benzenoid - Pyrrole - Heteroaromatic compound - Thiophene - Tertiary amine - Tertiary aliphatic amine - Ketone - Azacycle - Organic oxide - Organohalogen compound - Organic oxygen compound - Amine - Organochloride - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylpyrrolidines. These are polycyclic aromatic compounds containing a benzene ring linked to a pyrrolidine ring through a CC or CN bond. Pyrrolidine is a five-membered saturated aliphatic heterocycle with one nitrogen atom and four carbon atoms. |
| External Descriptors | Not available |
| Peso molecular | 305.800 g/mol |
|---|---|
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 305.064 Da |
| Monoisotopic Mass | 305.064 Da |
| Topological Polar Surface Area | 48.600 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 356.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |