Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Application:
Versatile acetylated neuraminic acid or sialic acid derivative. N-acetylneuraminic acid is often present as the terminal sugar of glycoproteins.
| Pubchem Sid | 504766042 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766042 |
| Sonrisas canónicas | CC(=O)NC1C(CC(OC1C(C(COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)OC)O)OC(=O)C |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| InChIKey | CAKDMYCBPKFKCV-DCDDNHAVSA-N |
| INCHI | 1S/C20H29NO13/c1-9(22)21-16-14(31-11(3)24)7-20(28,19(27)29-6)34-18(16)17(33-13(5)26)15(32-12(4)25)8-30-10(2)23/h14-18,28H,7-8H2,1-6H3,(H,21,22)/t14-,15+,16+,17+,18+,20-/m0/s1 |
| Isómeros SMILES | CC(=O)N[C@@H]1[C@H](C[C@](O[C@H]1[C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)OC)O)OC(=O)C |
| WGK Alemania | 3 |
| PubChem CID | 11123820 |
| Peso molecular | 491.45 |
| Reaxy-Rn | 3078340 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Sugar acids and derivatives - Sugar amino acids and derivatives - Pyranoid amino acids and derivatives - Neuraminic acids and derivatives |
| Direct Parent | N-acylneuraminic acids and derivatives |
| Alternative Parents | Pentacarboxylic acids and derivatives C-glucuronides C-glycosyl compounds Pyrans Oxanes Methyl esters Acetamides Secondary carboxylic acid amides Hemiacetals Oxacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | N-acylneuraminic acid or derivatives - Pentacarboxylic acid or derivatives - C-glucuronide - C-glycosyl compound - Glycosyl compound - Pyran - Oxane - Acetamide - Methyl ester - Carboxamide group - Carboxylic acid ester - Hemiacetal - Secondary carboxylic acid amide - Carboxylic acid derivative - Oxacycle - Organoheterocyclic compound - Hydrocarbon derivative - Organic oxide - Carbonyl group - Organic nitrogen compound - Organopnictogen compound - Organonitrogen compound - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-acylneuraminic acids and derivatives. These are neuraminic acids (or derivatives thereof) carrying an N-acyl substituent. |
| External Descriptors | Not available |
| Solubilidad | Slightly soluble in Chloroform |
|---|---|
| Sensibilidad | Heat Sensitive |
| Punto de fusión (°C) | 185-189 °C |
| Peso molecular | 491.400 g/mol |
| XLogP3 | -0.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 13 |
| Rotatable Bond Count | 14 |
| Exact Mass | 491.164 Da |
| Monoisotopic Mass | 491.164 Da |
| Topological Polar Surface Area | 190.000 Ų |
| Heavy Atom Count | 34 |
| Formal Charge | 0 |
| Complexity | 812.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 6 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |