Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1C(C2=CC=CC=C2CS1(=O)=O)N.Cl |
|---|---|
| IUPAC Name | 2,2-dioxo-3,4-dihydro-1H-isothiochromen-4-amine;hydrochloride |
| InChIKey | JPSRQJVVIKWEKQ-UHFFFAOYSA-N |
| INCHI | 1S/C9H11NO2S.ClH/c10-9-6-13(11,12)5-7-3-1-2-4-8(7)9;/h1-4,9H,5-6,10H2;1H |
| Isómeros SMILES | C1C(C2=CC=CC=C2CS1(=O)=O)N.Cl |
| PubChem CID | 45789657 |
| Peso molecular | 233.71 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Isothiochromanes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Isothiochromanes |
| Alternative Parents | 2-benzothiopyrans Aralkylamines Benzenoids Sulfones Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Isothiochromane - Benzothiopyran - 2-benzothiopyran - Aralkylamine - Benzenoid - Sulfone - Organic oxygen compound - Hydrocarbon derivative - Hydrochloride - Amine - Primary amine - Organonitrogen compound - Primary aliphatic amine - Organic nitrogen compound - Organic oxide - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as isothiochromanes. These are organic heterocyclic compounds containing an isothiochromane moiety. |
| External Descriptors | Not available |
| Peso molecular | 233.720 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 233.028 Da |
| Monoisotopic Mass | 233.028 Da |
| Topological Polar Surface Area | 68.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 280.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |