Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C2C(=C1)C3=C(C(=N2)Cl)NC=N3 |
|---|---|
| IUPAC Name | 4-chloro-3H-imidazo[4,5-c]quinoline |
| InChIKey | SHKUAAUCZDOPDI-UHFFFAOYSA-N |
| INCHI | 1S/C10H6ClN3/c11-10-9-8(12-5-13-9)6-3-1-2-4-7(6)14-10/h1-5H,(H,12,13) |
| Isómeros SMILES | C1=CC=C2C(=C1)C3=C(C(=N2)Cl)NC=N3 |
| PubChem CID | 11492148 |
| Peso molecular | 203.63 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Quinolines and derivatives |
| Subclass | Imidazoquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazoquinolines |
| Alternative Parents | Chloroquinolines Imidazo-[4,5-c]pyridines 2-halopyridines Benzenoids Aryl chlorides Imidazoles Heteroaromatic compounds Azacyclic compounds Organonitrogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazoquinoline - Chloroquinoline - Haloquinoline - Imidazopyridine - Imidazo-[4,5-c]pyridine - 2-halopyridine - Benzenoid - Aryl chloride - Pyridine - Aryl halide - Heteroaromatic compound - Imidazole - Azole - Azacycle - Organic nitrogen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as imidazoquinolines. These are aromatic heterocyclic compounds containing an imidazole ring fused to a quinoline ring system. In some configurations, the imidazole ring shares a nitrogen atom with the quinoline moiety. |
| External Descriptors | Not available |
| Peso molecular | 203.630 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 203.025 Da |
| Monoisotopic Mass | 203.025 Da |
| Topological Polar Surface Area | 41.600 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 223.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |