Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
4-Methyl-4-phenylpentan-2-one, also known as 4-Methyl-4-phenyl-2-pentanone, is a versatile ketone that finds extensive applications in various industries, particularly in the synthesis of pharmaceuticals and fine chemicals. This compound is characterized by its unique structure, which allows it to act as an effective intermediate in the production of complex organic molecules. Its ability to undergo various chemical reactions, such as reductions and condensations, makes it a valuable building block for researchers and manufacturers alike.
Application:
In the pharmaceutical industry, 4-Methyl-4-phenylpentan-2-one is utilized in the development of active pharmaceutical ingredients (APIs) due to its favorable reactivity and stability. Additionally, it serves as a key component in the formulation of fragrances and flavoring agents, enhancing the sensory attributes of consumer products. Its unique properties not only facilitate efficient synthesis but also contribute to the overall quality of end products, making it an essential compound for professionals seeking reliable and effective solutions in their formulations.
| ALogP | 2.7 |
|---|
| Pubchem Sid | 528760753 |
|---|---|
| Sonrisas canónicas | CC(=O)CC(C)(C)C1=CC=CC=C1 |
| IUPAC Name | 4-methyl-4-phenylpentan-2-one |
| InChIKey | PFDVPCSDZXZDMF-UHFFFAOYSA-N |
| INCHI | 1S/C12H16O/c1-10(13)9-12(2,3)11-7-5-4-6-8-11/h4-8H,9H2,1-3H3 |
| Isómeros SMILES | CC(=O)CC(C)(C)C1=CC=CC=C1 |
| Peso molecular | 176.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Phenylpropanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenylpropanes |
| Alternative Parents | Ketones Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylpropane - Ketone - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenylpropanes. These are organic compounds containing a phenylpropane moiety. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | May 08, 2025 | M694790 | |
| Certificate of Analysis | May 08, 2025 | M694790 | |
| Certificate of Analysis | May 08, 2025 | M694790 | |
| Certificate of Analysis | May 08, 2025 | M694790 |
| Índice de refracción | 1.508 - 1.512 |
|---|---|
| Punto de fusión (°C) | 122 - 123 °C |
| Peso molecular | 176.250 g/mol |
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 176.12 Da |
| Monoisotopic Mass | 176.12 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 176.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |