Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488188486 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488188486 |
| Sonrisas canónicas | CCC1CCC(CC1)C2=CC=C(C=C2)C#N |
| IUPAC Name | 4-(4-ethylcyclohexyl)benzonitrile |
| InChIKey | BBHJTCADCKZYSO-UHFFFAOYSA-N |
| INCHI | 1S/C15H19N/c1-2-12-3-7-14(8-4-12)15-9-5-13(11-16)6-10-15/h5-6,9-10,12,14H,2-4,7-8H2,1H3 |
| Isómeros SMILES | CCC1CCC(CC1)C2=CC=C(C=C2)C#N |
| PubChem CID | 175307 |
| Peso molecular | 213.32 |
| Reaxy-Rn | 6768665 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzonitriles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzonitriles |
| Alternative Parents | Nitriles Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzonitrile - Nitrile - Carbonitrile - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzonitriles. These are organic compounds containing a benzene bearing a nitrile substituent. |
| External Descriptors | Not available |
| Solubilidad | Soluble in Methanol |
|---|---|
| Punto de fusión (°C) | 41 °C |
| Peso molecular | 213.320 g/mol |
| XLogP3 | 5.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 213.152 Da |
| Monoisotopic Mass | 213.152 Da |
| Topological Polar Surface Area | 23.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 246.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Wei Zhang, LianRui Duan, JiaYi Liang, Ziyan Liu, GuangYu Jiang, Ziyan Wang, Huiwen Kang, Danyang Huang, Ai Gao. (2025) Mechanistic Insights into the Effects of Liquid Crystalline Monomers on Intestinal Stem Cell Differentiation Imbalance by Integrating Machine Learning and Adverse Outcome Pathway Framework Based on Organoids. ENVIRONMENTAL SCIENCE & TECHNOLOGY, [PMID:40878620] [10.1021/acs.est.5c07403] |