Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C=CS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
|---|---|
| IUPAC Name | 4-ethenylsulfonylbenzoic acid |
| InChIKey | XVNBCTUERGUCCX-UHFFFAOYSA-N |
| INCHI | 1S/C9H8O4S/c1-2-14(12,13)8-5-3-7(4-6-8)9(10)11/h2-6H,1H2,(H,10,11) |
| Isómeros SMILES | C=CS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
| PubChem CID | 13394541 |
| Peso molecular | 212.22 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzenesulfonyl compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzenesulfonyl compounds |
| Alternative Parents | Benzoic acids Benzoyl derivatives Sulfones Carboxylic acids Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzenesulfonyl group - Benzoic acid - Benzoic acid or derivatives - Benzoyl - Sulfonyl - Sulfone - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzenesulfonyl compounds. These are aromatic compounds containing a benzenesulfonyl group, which consists of a monocyclic benzene moiety that carries a sulfonyl group. |
| External Descriptors | Not available |
| Peso molecular | 212.220 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 212.014 Da |
| Monoisotopic Mass | 212.014 Da |
| Topological Polar Surface Area | 79.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 317.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Shaojie Chen, Hao Tang, Xiaoliang Fan, Bohan Li, Yaomin Wang, Wei Zhou, Xiaoyu Jiang, Xiaomin Dong, Yanyi Wang, Peng Zhao, Tianwen Ye, Bolin An, Yijun Zheng, Chao Zhong. (2026) Bio-orthogonal functionalization of bacterial cellulose combining metabolic glycoengineering and click chemistry. Nature Communications, [PMID:41633993] [10.1038/s41467-026-69130-8] |