Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C([C@@H]([C@H](C(=O)C(=O)C(=O)O)O)O)O |
|---|---|
| IUPAC Name | (4R,5S)-4,5,6-trihydroxy-2,3-dioxohexanoic acid |
| InChIKey | GJQWCDSAOUMKSE-STHAYSLISA-N |
| INCHI | 1S/C6H8O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-3,7-9H,1H2,(H,12,13)/t2-,3+/m0/s1 |
| Peso molecular | 192.120 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sugar acids and derivatives |
| Alternative Parents | Hexoses Medium-chain keto acids and derivatives Beta-keto acids and derivatives Beta-hydroxy ketones Alpha-keto acids and derivatives Alpha-diketones Acyloins Alpha-hydroxy ketones Secondary alcohols Polyols Monocarboxylic acids and derivatives Carboxylic acids Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hexose monosaccharide - Medium-chain keto acid - Beta-keto acid - Sugar acid - Acyloin - Alpha-keto acid - Alpha-diketone - Beta-hydroxy ketone - Keto acid - Monosaccharide - Alpha-hydroxy ketone - Ketone - Secondary alcohol - Carboxylic acid - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Polyol - Hydrocarbon derivative - Carbonyl group - Alcohol - Organic oxide - Primary alcohol - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as sugar acids and derivatives. These are compounds containing a saccharide unit which bears a carboxylic acid group. |
| External Descriptors | Oxo fatty acids |
| Peso molecular | 192.120 g/mol |
|---|---|
| XLogP3 | -1.800 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 5 |
| Exact Mass | 192.027 Da |
| Monoisotopic Mass | 192.027 Da |
| Topological Polar Surface Area | 132.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 233.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |