Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%, ~2:1 mixture of diaste(REO)mers for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1C(O[Si](N1C)(CC=C)Cl)C2=CC=CC=C2 |
|---|---|
| IUPAC Name | (4S,5S)-2-chloro-3,4-dimethyl-5-phenyl-2-prop-2-enyl-1,3,2-oxazasilolidine |
| InChIKey | XHCRAANIMMYPDV-APBZJUGRSA-N |
| INCHI | 1S/C13H18ClNOSi/c1-4-10-17(14)15(3)11(2)13(16-17)12-8-6-5-7-9-12/h4-9,11,13H,1,10H2,2-3H3/t11-,13+,17?/m0/s1 |
| Isómeros SMILES | C[C@H]1[C@@H](O[Si](N1C)(CC=C)Cl)C2=CC=CC=C2 |
| WGK Alemania | 3 |
| PubChem CID | 10333223 |
| Peso molecular | 267.83 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzene and substituted derivatives |
| Alternative Parents | Oxacyclic compounds Organochlorosilanes Organic metalloid salts N-silyl compounds Azacyclic compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Monocyclic benzene moiety - Organoheterocyclic compound - Organic metalloid salt - Azacycle - Oxacycle - Organochlorosilane - Organoheterosilane - N-silyl compound - Organic nitrogen compound - Organic metalloid moeity - Organonitrogen compound - Hydrocarbon derivative - Organooxygen compound - Organosilicon compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzene and substituted derivatives. These are aromatic compounds containing one monocyclic ring system consisting of benzene. |
| External Descriptors | Not available |
| Sensibilidad | moisture sensitive |
|---|---|
| Punto de inflamación (°F) | 100.4 °F |
| Punto de inflamación (°C) | 38 °C |
| Peso molecular | 267.820 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 3 |
| Exact Mass | 267.085 Da |
| Monoisotopic Mass | 267.085 Da |
| Topological Polar Surface Area | 12.500 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 283.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |