Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1COC(O1)C2=CC=C(S2)C(=O)C3=CC=CC=C3C(F)(F)F |
|---|---|
| IUPAC Name | [5-(1,3-dioxolan-2-yl)thiophen-2-yl]-[2-(trifluoromethyl)phenyl]methanone |
| InChIKey | WSLYDGYFBVIXKX-UHFFFAOYSA-N |
| INCHI | 1S/C15H11F3O3S/c16-15(17,18)10-4-2-1-3-9(10)13(19)11-5-6-12(22-11)14-20-7-8-21-14/h1-6,14H,7-8H2 |
| Isómeros SMILES | C1COC(O1)C2=CC=C(S2)C(=O)C3=CC=CC=C3C(F)(F)F |
| PubChem CID | 24723485 |
| Peso molecular | 328.31 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones - Aryl ketones - Phenylketones |
| Direct Parent | Aryl-phenylketones |
| Alternative Parents | Trifluoromethylbenzenes Thiophene carboxylic acids and derivatives Benzoyl derivatives 2,5-disubstituted thiophenes Heteroaromatic compounds 1,3-dioxolanes Oxacyclic compounds Acetals Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides Aldehydes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl-phenylketone - Trifluoromethylbenzene - Benzoyl - Thiophene carboxylic acid or derivatives - 2,5-disubstituted thiophene - Monocyclic benzene moiety - Benzenoid - Meta-dioxolane - Heteroaromatic compound - Thiophene - Acetal - Oxacycle - Organoheterocyclic compound - Organic oxide - Hydrocarbon derivative - Alkyl halide - Alkyl fluoride - Organohalogen compound - Organofluoride - Aldehyde - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aryl-phenylketones. These are aromatic compounds containing a ketone substituted by one aryl group, and a phenyl group. |
| External Descriptors | Not available |
| Peso molecular | 328.300 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 328.038 Da |
| Monoisotopic Mass | 328.038 Da |
| Topological Polar Surface Area | 63.800 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 409.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |