Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C2C(=C1)C3=C(N2)C4=CC=CC=C4NC3=O |
|---|---|
| IUPAC Name | 5,11-dihydroindolo[3,2-c]quinolin-6-one |
| InChIKey | KHHVLPFHXHKOEJ-UHFFFAOYSA-N |
| INCHI | 1S/C15H10N2O/c18-15-13-9-5-1-3-7-11(9)16-14(13)10-6-2-4-8-12(10)17-15/h1-8,16H,(H,17,18) |
| Isómeros SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=CC=CC=C4NC3=O |
| PubChem CID | 2784881 |
| Peso molecular | 234.26 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Quinolines and derivatives |
| Subclass | Indoloquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indoloquinolines |
| Alternative Parents | Pyrrolo[3,2-c]quinolines Gamma carbolines Hydroquinolones Hydroquinolines Pyrrolopyridines Indoles Pyridinones Benzenoids Vinylogous amides Pyrroles Heteroaromatic compounds Lactams Azacyclic compounds Hydrocarbon derivatives Organic oxides Organonitrogen compounds Organooxygen compounds Organopnictogen compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indoloquinoline - Gamma-carboline - Pyrrolo[3,2-c]quinoline - Pyrroloquinoline - Dihydroquinolone - Dihydroquinoline - Indole - Indole or derivatives - Pyrrolopyridine - Pyridinone - Pyridine - Benzenoid - Heteroaromatic compound - Vinylogous amide - Pyrrole - Lactam - Azacycle - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic nitrogen compound - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as indoloquinolines. These are polycyclic aromatic compounds containing an indole fused to a quinoline. |
| External Descriptors | Not available |
| Punto de fusión (°C) | 379-381° |
|---|---|
| Peso molecular | 234.250 g/mol |
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 234.079 Da |
| Monoisotopic Mass | 234.079 Da |
| Topological Polar Surface Area | 44.900 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 356.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |