| Sonrisas canónicas | C1=C(C=C(C=C1Cl)Cl)CC2=CN=C(S2)N |
|---|---|
| IUPAC Name | 5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-amine |
| InChIKey | ZHJOMPVZQHLJTE-UHFFFAOYSA-N |
| INCHI | 1S/C10H8Cl2N2S/c11-7-1-6(2-8(12)4-7)3-9-5-14-10(13)15-9/h1-2,4-5H,3H2,(H2,13,14) |
| Peso molecular | 259.149 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | 2,5-disubstituted thiazoles Aryl chlorides 2-amino-1,3-thiazoles Heteroaromatic compounds Azacyclic compounds Primary amines Organopnictogen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 1,3-dichlorobenzene - 2,5-disubstituted 1,3-thiazole - Aryl chloride - Aryl halide - 1,3-thiazol-2-amine - Thiazole - Azole - Heteroaromatic compound - Organoheterocyclic compound - Azacycle - Primary amine - Organonitrogen compound - Organochloride - Organohalogen compound - Organopnictogen compound - Amine - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
| Peso molecular | 259.149 g/mol |
|---|---|
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 257.979 Da |
| Monoisotopic Mass | 257.979 Da |
| Topological Polar Surface Area | 67.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 208.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![5-[(3,5-Dichlorophenyl)methyl]-1,3-thiazol-2-amine - ≥95% , CAS No.306321-16-4](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)