≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC1=CC=C(C=C1)COC2=C(C=C3C(=C2)C(=O)OC3=O)OCC4=CC=C(C=C4)OC |
|---|---|
| InChIKey | BLMQFZDSZGKYFR-UHFFFAOYSA-N |
| INCHI | 1S/C24H20O7/c1-27-17-7-3-15(4-8-17)13-29-21-11-19-20(24(26)31-23(19)25)12-22(21)30-14-16-5-9-18(28-2)10-6-16/h3-12H,13-14H2,1-2H3 |
| Isómeros SMILES | COC1=CC=C(C=C1)COC2=C(C=C3C(=C2)C(=O)OC3=O)OCC4=CC=C(C=C4)OC |
| Peso molecular | 420.41 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Benzofurans |
| Subclass | Benzofuranones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phthalic anhydrides |
| Alternative Parents | Isobenzofuranones Phenoxy compounds Methoxybenzenes Anisoles Alkyl aryl ethers Carboxylic acid anhydrides Oxacyclic compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Phthalic_anhydride - Phthalic anhydride - Isobenzofuranone - Isocoumaran - Anisole - Phenol ether - Phenoxy compound - Methoxybenzene - Alkyl aryl ether - Benzenoid - Monocyclic benzene moiety - Carboxylic acid anhydride - Ether - Carboxylic acid derivative - Oxacycle - Organic oxygen compound - Organic oxide - Organooxygen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phthalic anhydrides. These are compounds containing a phthalic anhydride moiety (or a derivative thereof), which consists of a benzene fused to a furan-1,3-dione. |
| External Descriptors | Not available |
| Punto de ebullición (°C) | 625.0±55.0°C at 760 mmHg |
|---|---|
| Peso molecular | 420.400 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 8 |
| Exact Mass | 420.121 Da |
| Monoisotopic Mass | 420.121 Da |
| Topological Polar Surface Area | 80.300 Ų |
| Heavy Atom Count | 31 |
| Formal Charge | 0 |
| Complexity | 555.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
