Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCCCCCCOC1C(C(C(C(O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
|---|---|
| IUPAC Name | (5-acetamido-3,4-diacetyloxy-6-octoxyoxan-2-yl)methyl acetate |
| InChIKey | MKWRBOCGIQFSER-UHFFFAOYSA-N |
| INCHI | 1S/C22H37NO9/c1-6-7-8-9-10-11-12-28-22-19(23-14(2)24)21(31-17(5)27)20(30-16(4)26)18(32-22)13-29-15(3)25/h18-22H,6-13H2,1-5H3,(H,23,24) |
| Peso molecular | 459.500 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Aminosaccharides |
| Direct Parent | N-acyl-alpha-hexosamines |
| Alternative Parents | Fatty acyl glycosides of mono- and disaccharides Alkyl glycosides O-glycosyl compounds Tricarboxylic acids and derivatives Oxanes Monosaccharides Acetamides Secondary carboxylic acid amides Carboxylic acid esters Acetals Oxacyclic compounds Hydrocarbon derivatives Organopnictogen compounds Carbonyl compounds Organonitrogen compounds Organic oxides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Fatty acyl glycoside - Fatty acyl glycoside of mono- or disaccharide - N-acyl-alpha-hexosamine - Alkyl glycoside - Glycosyl compound - O-glycosyl compound - Tricarboxylic acid or derivatives - Monosaccharide - Oxane - Fatty acyl - Acetamide - Carboxylic acid ester - Carboxamide group - Secondary carboxylic acid amide - Oxacycle - Acetal - Carboxylic acid derivative - Organoheterocyclic compound - Organonitrogen compound - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Carbonyl group - Organic nitrogen compound - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-acyl-alpha-hexosamines. These are carbohydrate derivatives containing a hexose moiety in which the oxygen atom is replaced by an n-acyl group. |
| External Descriptors | Not available |
| Peso molecular | 459.500 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 16 |
| Exact Mass | 459.247 Da |
| Monoisotopic Mass | 459.247 Da |
| Topological Polar Surface Area | 126.000 Ų |
| Heavy Atom Count | 32 |
| Formal Charge | 0 |
| Complexity | 625.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 5 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |