Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(=O)NC1=C(NC(=O)N(C1=O)C)N |
|---|---|
| IUPAC Name | N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)acetamide |
| InChIKey | POQOTWQIYYNXAT-UHFFFAOYSA-N |
| INCHI | 1S/C7H10N4O3/c1-3(12)9-4-5(8)10-7(14)11(2)6(4)13/h8H2,1-2H3,(H,9,12)(H,10,14) |
| Isómeros SMILES | CC(=O)NC1=C(NC(=O)N(C1=O)C)N |
| WGK Alemania | 3 |
| PubChem CID | 88299 |
| Peso molecular | 198.18 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | N-arylamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-acetylarylamines |
| Alternative Parents | Aminopyrimidines and derivatives Pyrimidones Hydropyrimidines Vinylogous amides Acetamides Heteroaromatic compounds Ureas Amino acids and derivatives Secondary carboxylic acid amides Lactams Azacyclic compounds Primary amines Carbonyl compounds Hydrocarbon derivatives Organopnictogen compounds Organic oxides |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | N-acetylarylamine - Aminopyrimidine - Pyrimidone - Hydropyrimidine - Pyrimidine - Heteroaromatic compound - Acetamide - Vinylogous amide - Amino acid or derivatives - Carboxamide group - Lactam - Urea - Secondary carboxylic acid amide - Carboxylic acid derivative - Azacycle - Organoheterocyclic compound - Organic oxygen compound - Hydrocarbon derivative - Amine - Organic oxide - Carbonyl group - Organooxygen compound - Primary amine - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-acetylarylamines. These are acetamides where one or more amide hydrogens is substituted by an aryl group. |
| External Descriptors | aromatic amide |
| Peso molecular | 198.180 g/mol |
|---|---|
| XLogP3 | -1.900 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 198.075 Da |
| Monoisotopic Mass | 198.075 Da |
| Topological Polar Surface Area | 105.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 347.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |