Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C(C=C1)COC(=O)CCC(=O)CN.Cl |
|---|---|
| IUPAC Name | benzyl 5-amino-4-oxopentanoate;hydrochloride |
| InChIKey | GHMCTRQKEALPCK-UHFFFAOYSA-N |
| INCHI | 1S/C12H15NO3.ClH/c13-8-11(14)6-7-12(15)16-9-10-4-2-1-3-5-10;/h1-5H,6-9,13H2;1H |
| Isómeros SMILES | C1=CC=C(C=C1)COC(=O)CCC(=O)CN.Cl |
| PubChem CID | 22253144 |
| Peso molecular | 257.71 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives |
| Direct Parent | Delta amino acids and derivatives |
| Alternative Parents | Benzyloxycarbonyls Gamma-keto acids and derivatives Fatty acid esters Alpha-amino ketones Carboxylic acid esters Monocarboxylic acids and derivatives Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Delta amino acid or derivatives - Benzyloxycarbonyl - Gamma-keto acid - Fatty acid ester - Monocyclic benzene moiety - Fatty acyl - Benzenoid - Keto acid - Alpha-aminoketone - Carboxylic acid ester - Ketone - Monocarboxylic acid or derivatives - Primary aliphatic amine - Amine - Organooxygen compound - Primary amine - Hydrochloride - Hydrocarbon derivative - Organic nitrogen compound - Carbonyl group - Organic oxide - Organic oxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as delta amino acids and derivatives. These are compounds containing a carboxylic acid group and an amino group at the C5 carbon atom. |
| External Descriptors | Not available |
| Peso molecular | 257.709 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 7 |
| Exact Mass | 257.082 Da |
| Monoisotopic Mass | 257.082 Da |
| Topological Polar Surface Area | 69.400 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 234.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |