≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CC(=CC(=C1OC)C(F)(F)F)CBr |
|---|---|
| IUPAC Name | 5-(bromomethyl)-2-methoxy-1-methyl-3-(trifluoromethyl)benzene |
| InChIKey | JKXBKNDMQOOWQU-UHFFFAOYSA-N |
| INCHI | 1S/C10H10BrF3O/c1-6-3-7(5-11)4-8(9(6)15-2)10(12,13)14/h3-4H,5H2,1-2H3 |
| Isómeros SMILES | CC1=CC(=CC(=C1OC)C(F)(F)F)CBr |
| PubChem CID | 86277706 |
| Peso molecular | 283.09 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Trifluoromethylbenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Trifluoromethylbenzenes |
| Alternative Parents | Phenoxy compounds Methoxybenzenes Benzyl bromides Anisoles Toluenes Alkyl aryl ethers Organofluorides Organobromides Hydrocarbon derivatives Alkyl fluorides Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Trifluoromethylbenzene - Phenoxy compound - Anisole - Methoxybenzene - Benzyl halide - Benzyl bromide - Phenol ether - Alkyl aryl ether - Toluene - Ether - Organic oxygen compound - Organofluoride - Organobromide - Organohalogen compound - Organooxygen compound - Hydrocarbon derivative - Alkyl halide - Alkyl fluoride - Alkyl bromide - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trifluoromethylbenzenes. These are organofluorine compounds that contain a benzene ring substituted with one or more trifluoromethyl groups. |
| External Descriptors | Not available |
| Peso molecular | 283.080 g/mol |
|---|---|
| XLogP3 | 3.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 281.987 Da |
| Monoisotopic Mass | 281.987 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 207.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
