≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C(SC2=C1SC(=C2)Br)C(=O)O |
|---|---|
| IUPAC Name | 5-bromothieno[3,2-b]thiophene-2-carboxylic acid |
| InChIKey | PMZFZHLHTDFWBI-UHFFFAOYSA-N |
| INCHI | 1S/C7H3BrO2S2/c8-6-2-4-3(12-6)1-5(11-4)7(9)10/h1-2H,(H,9,10) |
| Isómeros SMILES | C1=C(SC2=C1SC(=C2)Br)C(=O)O |
| PubChem CID | 56923678 |
| Peso molecular | 263.1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Thienothiophenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thienothiophenes |
| Alternative Parents | Thiophene carboxylic acids 2,3,5-trisubstituted thiophenes Aryl bromides Heteroaromatic compounds Carboxylic acids Organooxygen compounds Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Thienothiophene - Thiophene carboxylic acid - Thiophene carboxylic acid or derivatives - 2,3,5-trisubstituted thiophene - Aryl bromide - Aryl halide - Heteroaromatic compound - Thiophene - Carboxylic acid - Carboxylic acid derivative - Hydrocarbon derivative - Organooxygen compound - Organobromide - Organohalogen compound - Organic oxide - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as thienothiophenes. These are organic compounds containing two thiophene rings fused to each other. |
| External Descriptors | Not available |
| Peso molecular | 263.100 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 261.876 Da |
| Monoisotopic Mass | 261.876 Da |
| Topological Polar Surface Area | 93.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 212.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![5-Bromothieno[3,2-b]thiophene-2-carboxylic acid - ≥95% , CAS No.1378448-42-0](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)